Difference between revisions of "PWY-7456"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7649 CPD-7649] == * common-name: ** dopamine 3-o-sulfate * smiles: ** c1(=c(cc[n+])c=c(os(=...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CRPB-all-trans-Retinol CRPB-all-trans-Retinol] == * common-name: ** an all-trans retinol-[cellu...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7649 CPD-7649] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CRPB-all-trans-Retinol CRPB-all-trans-Retinol] ==
 
* common-name:
 
* common-name:
** dopamine 3-o-sulfate
+
** an all-trans retinol-[cellular-retinol-binding-protein]
* smiles:
 
** c1(=c(cc[n+])c=c(os(=o)(=o)[o-])c(o)=c1)
 
* inchi-key:
 
** nzkryjgnypyxjz-uhfffaoysa-n
 
* molecular-weight:
 
** 233.239
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12581]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN6666-9]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dopamine 3-o-sulfate}}
+
{{#set: common-name=an all-trans retinol-[cellular-retinol-binding-protein]}}
{{#set: inchi-key=inchikey=nzkryjgnypyxjz-uhfffaoysa-n}}
 
{{#set: molecular-weight=233.239}}
 

Revision as of 14:18, 26 August 2019

Metabolite CRPB-all-trans-Retinol

  • common-name:
    • an all-trans retinol-[cellular-retinol-binding-protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an all-trans retinol-[cellular-retinol-binding-protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.