Difference between revisions of "CPD-341"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-METHYL-1-246-TRIHYDROXYPHENYLBUTAN == * common-name: ** phlorisovalerophenone * smiles: ** cc(cc(c1(c(=cc(=cc=1o)o)o))=o)c * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite Charged-CYS-tRNAs == * common-name: ** an l-cysteinyl-[trnacys] == Reaction(s) known to consume the compound == * RXN-16637 == Reacti...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Charged-CYS-tRNAs == |
* common-name: | * common-name: | ||
− | ** | + | ** an l-cysteinyl-[trnacys] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-16637]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[CYSTEINE--TRNA-LIGASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an l-cysteinyl-[trnacys]}} |
− | |||
− |
Revision as of 15:24, 5 January 2021
Contents
Metabolite Charged-CYS-tRNAs
- common-name:
- an l-cysteinyl-[trnacys]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an l-cysteinyl-[trnacys" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.