Difference between revisions of "CPD-341"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-METHYL-1-246-TRIHYDROXYPHENYLBUTAN == * common-name: ** phlorisovalerophenone * smiles: ** cc(cc(c1(c(=cc(=cc=1o)o)o))=o)c * inchi-key:...")
(Created page with "Category:metabolite == Metabolite Charged-CYS-tRNAs == * common-name: ** an l-cysteinyl-[trnacys] == Reaction(s) known to consume the compound == * RXN-16637 == Reacti...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-METHYL-1-246-TRIHYDROXYPHENYLBUTAN ==
+
== Metabolite Charged-CYS-tRNAs ==
 
* common-name:
 
* common-name:
** phlorisovalerophenone
+
** an l-cysteinyl-[trnacys]
* smiles:
 
** cc(cc(c1(c(=cc(=cc=1o)o)o))=o)c
 
* inchi-key:
 
** vsdwhzgjgwmirn-uhfffaoysa-n
 
* molecular-weight:
 
** 210.229
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7811]]
+
* [[RXN-16637]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[CYSTEINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=phlorisovalerophenone}}
+
{{#set: common-name=an l-cysteinyl-[trnacys]}}
{{#set: inchi-key=inchikey=vsdwhzgjgwmirn-uhfffaoysa-n}}
 
{{#set: molecular-weight=210.229}}
 

Revision as of 15:24, 5 January 2021

Metabolite Charged-CYS-tRNAs

  • common-name:
    • an l-cysteinyl-[trnacys]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an l-cysteinyl-[trnacys" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.