Difference between revisions of "D-Gal-NAc--Glycoproteins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-108 == * common-name: ** 4-methylphenol * smiles: ** cc1(c=cc(=cc=1)o) * inchi-key: ** iwdclrjobjjrnh-uhfffaoysa-n * molecular-weight...")
(Created page with "Category:metabolite == Metabolite NICOTINAMIDE_NUCLEOTIDE == * common-name: ** β-nicotinamide d-ribonucleotide * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-108 ==
+
== Metabolite NICOTINAMIDE_NUCLEOTIDE ==
 
* common-name:
 
* common-name:
** 4-methylphenol
+
** β-nicotinamide d-ribonucleotide
 
* smiles:
 
* smiles:
** cc1(c=cc(=cc=1)o)
+
** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)n)c=2))
 
* inchi-key:
 
* inchi-key:
** iwdclrjobjjrnh-uhfffaoysa-n
+
** dayljwodmcoqew-turqnecasa-m
 
* molecular-weight:
 
* molecular-weight:
** 108.14
+
** 333.214
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15588]]
+
* [[2.7.7.1-RXN]]
 +
* [[RXN-5841]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11319]]
+
* [[DNA-LIGASE-NAD+-RXN]]
* [[RXN-15588]]
+
* [[NADPYROPHOSPHAT-RXN]]
 +
* [[RXN-17920]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-methylphenol}}
+
{{#set: common-name=β-nicotinamide d-ribonucleotide}}
{{#set: inchi-key=inchikey=iwdclrjobjjrnh-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=dayljwodmcoqew-turqnecasa-m}}
{{#set: molecular-weight=108.14}}
+
{{#set: molecular-weight=333.214}}

Revision as of 15:24, 5 January 2021

Metabolite NICOTINAMIDE_NUCLEOTIDE

  • common-name:
    • β-nicotinamide d-ribonucleotide
  • smiles:
    • c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)n)c=2))
  • inchi-key:
    • dayljwodmcoqew-turqnecasa-m
  • molecular-weight:
    • 333.214

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality