Difference between revisions of "CPD-2182"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Amino-Acids-20 == * common-name: ** a proteinogenic amino acid == Reaction(s) known to consume the compound == * L-AMINO-ACID-OXIDASE-R...")
(Created page with "Category:metabolite == Metabolite GLUCOSAMINE-1P == * common-name: ** d-glucosamine 1-phosphate * smiles: ** c(o)c1(oc(op(=o)([o-])[o-])c([n+])c(o)c(o)1) * inchi-key: ** y...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Amino-Acids-20 ==
+
== Metabolite GLUCOSAMINE-1P ==
 
* common-name:
 
* common-name:
** a proteinogenic amino acid
+
** d-glucosamine 1-phosphate
 +
* smiles:
 +
** c(o)c1(oc(op(=o)([o-])[o-])c([n+])c(o)c(o)1)
 +
* inchi-key:
 +
** ymjbyrvfgyxulk-qzabapfnsa-m
 +
* molecular-weight:
 +
** 258.144
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[L-AMINO-ACID-OXIDASE-RXN]]
+
* [[2.3.1.157-RXN]]
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
 
* [[RXN-6601]]
 
* [[RXN66-336]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.4.11.1-RXN]]
 
* [[3.4.11.4-RXN]]
 
* [[3.4.13.18-RXN]]
 
* [[3.4.13.9-RXN]]
 
* [[3.4.16.2-RXN]]
 
* [[3.4.17.19-RXN]]
 
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
 
* [[RXN0-5204]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a proteinogenic amino acid}}
+
{{#set: common-name=d-glucosamine 1-phosphate}}
 +
{{#set: inchi-key=inchikey=ymjbyrvfgyxulk-qzabapfnsa-m}}
 +
{{#set: molecular-weight=258.144}}

Revision as of 15:24, 5 January 2021

Metabolite GLUCOSAMINE-1P

  • common-name:
    • d-glucosamine 1-phosphate
  • smiles:
    • c(o)c1(oc(op(=o)([o-])[o-])c([n+])c(o)c(o)1)
  • inchi-key:
    • ymjbyrvfgyxulk-qzabapfnsa-m
  • molecular-weight:
    • 258.144

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality