Difference between revisions of "DIPHTINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite D-GLUCARATE == * common-name: ** d-glucarate * smiles: ** c(=o)(c(o)c(o)c(o)c(o)c(=o)[o-])[o-] * inchi-key: ** dslzvsrjtyrbfb-lleiaeiesa-...") |
(Created page with "Category:metabolite == Metabolite Apocytochromes-c == * common-name: ** an apo-[c-type cytochrome] == Reaction(s) known to consume the compound == * HOLOCYTOCHROME-C-SYN...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Apocytochromes-c == |
* common-name: | * common-name: | ||
− | ** | + | ** an apo-[c-type cytochrome] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[HOLOCYTOCHROME-C-SYNTHASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[HOLOCYTOCHROME-C-SYNTHASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an apo-[c-type cytochrome]}} |
− | |||
− |
Revision as of 15:24, 5 January 2021
Contents
Metabolite Apocytochromes-c
- common-name:
- an apo-[c-type cytochrome]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an apo-[c-type cytochrome" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.