Difference between revisions of "S-ubiquitinyl-UCP-E2-L-cysteine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Diphthine-methyl-ester-EF2 == * common-name: ** a diphthine methyl ester-[translation elongation factor 2] == Reaction(s) known to consum...")
(Created page with "Category:metabolite == Metabolite CPD-17382 == * common-name: ** (3r)-hydroxy-tetracosapentaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Diphthine-methyl-ester-EF2 ==
+
== Metabolite CPD-17382 ==
 
* common-name:
 
* common-name:
** a diphthine methyl ester-[translation elongation factor 2]
+
** (3r)-hydroxy-tetracosapentaenoyl-coa
 +
* smiles:
 +
** ccc=ccc=ccc=ccc=ccc=ccccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 +
* inchi-key:
 +
** drqaurckckdinz-kpyxopptsa-j
 +
* molecular-weight:
 +
** 1120.05
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15776]]
+
* [[RXN-16130]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15775]]
+
* [[RXN-16129]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a diphthine methyl ester-[translation elongation factor 2]}}
+
{{#set: common-name=(3r)-hydroxy-tetracosapentaenoyl-coa}}
 +
{{#set: inchi-key=inchikey=drqaurckckdinz-kpyxopptsa-j}}
 +
{{#set: molecular-weight=1120.05}}

Revision as of 15:25, 5 January 2021

Metabolite CPD-17382

  • common-name:
    • (3r)-hydroxy-tetracosapentaenoyl-coa
  • smiles:
    • ccc=ccc=ccc=ccc=ccc=ccccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • drqaurckckdinz-kpyxopptsa-j
  • molecular-weight:
    • 1120.05

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality