Difference between revisions of "CPD-13473"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-INDOLYLGLYCOLALDEHYDE == * common-name: ** indole-3-glycol aldehyde * smiles: ** c2(=c(c1(c=cc=cc=1n2))c(o)c=o) * inchi-key: ** xkzdnwm...") |
(Created page with "Category:metabolite == Metabolite COUMARYL-ALCOHOL == * common-name: ** 4-coumaryl alcohol * smiles: ** c(=cc1(=cc=c(o)c=c1))co * inchi-key: ** ptnlhdgqwugons-owojbtedsa-n...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite COUMARYL-ALCOHOL == |
* common-name: | * common-name: | ||
− | ** | + | ** 4-coumaryl alcohol |
* smiles: | * smiles: | ||
− | ** | + | ** c(=cc1(=cc=c(o)c=c1))co |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ptnlhdgqwugons-owojbtedsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 150.177 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-1102]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=4-coumaryl alcohol}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ptnlhdgqwugons-owojbtedsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=150.177}} |
Revision as of 15:25, 5 January 2021
Contents
Metabolite COUMARYL-ALCOHOL
- common-name:
- 4-coumaryl alcohol
- smiles:
- c(=cc1(=cc=c(o)c=c1))co
- inchi-key:
- ptnlhdgqwugons-owojbtedsa-n
- molecular-weight:
- 150.177