Difference between revisions of "CPD-19013"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14375 == * common-name: ** a glycopeptide-d-mannosyl-n4-n-acetyl-d-glucosamine == Reaction(s) known to consume the compound == == Rea...")
(Created page with "Category:metabolite == Metabolite CPD-11879 == * common-name: ** 3,4-dihydroxymandelate * smiles: ** c(=o)([o-])c(c1(=cc=c(o)c(o)=c1))o * inchi-key: ** rghmisiykihajw-ssdo...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14375 ==
+
== Metabolite CPD-11879 ==
 
* common-name:
 
* common-name:
** a glycopeptide-d-mannosyl-n4-n-acetyl-d-glucosamine
+
** 3,4-dihydroxymandelate
 +
* smiles:
 +
** c(=o)([o-])c(c1(=cc=c(o)c(o)=c1))o
 +
* inchi-key:
 +
** rghmisiykihajw-ssdottswsa-m
 +
* molecular-weight:
 +
** 183.14
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.2.1.96-RXN]]
+
* [[RXN-10912]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a glycopeptide-d-mannosyl-n4-n-acetyl-d-glucosamine}}
+
{{#set: common-name=3,4-dihydroxymandelate}}
 +
{{#set: inchi-key=inchikey=rghmisiykihajw-ssdottswsa-m}}
 +
{{#set: molecular-weight=183.14}}

Revision as of 15:25, 5 January 2021

Metabolite CPD-11879

  • common-name:
    • 3,4-dihydroxymandelate
  • smiles:
    • c(=o)([o-])c(c1(=cc=c(o)c(o)=c1))o
  • inchi-key:
    • rghmisiykihajw-ssdottswsa-m
  • molecular-weight:
    • 183.14

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality