Difference between revisions of "23S-rRNA-N7-methylguanine-2069"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 23S-rRNA-N7-methylguanine-2069 == * common-name: ** an n7-methylguanine2069 in 23s rrna == Reaction(s) known to consume the compound == =...")
(Created page with "Category:metabolite == Metabolite CPD-8076 == * common-name: ** 1-18:3-2-16:1-monogalactosyldiacylglycerol * smiles: ** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 23S-rRNA-N7-methylguanine-2069 ==
+
== Metabolite CPD-8076 ==
 
* common-name:
 
* common-name:
** an n7-methylguanine2069 in 23s rrna
+
** 1-18:3-2-16:1-monogalactosyldiacylglycerol
 +
* smiles:
 +
** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccccccccc)=o)=o
 +
* inchi-key:
 +
** syspljxkzrpipm-lwnbrhqxsa-n
 +
* molecular-weight:
 +
** 751.052
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-6950]]
+
* [[RXN-8297]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an n7-methylguanine2069 in 23s rrna}}
+
{{#set: common-name=1-18:3-2-16:1-monogalactosyldiacylglycerol}}
 +
{{#set: inchi-key=inchikey=syspljxkzrpipm-lwnbrhqxsa-n}}
 +
{{#set: molecular-weight=751.052}}

Revision as of 15:25, 5 January 2021

Metabolite CPD-8076

  • common-name:
    • 1-18:3-2-16:1-monogalactosyldiacylglycerol
  • smiles:
    • ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccccccccc)=o)=o
  • inchi-key:
    • syspljxkzrpipm-lwnbrhqxsa-n
  • molecular-weight:
    • 751.052

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality