Difference between revisions of "Decanoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12897 == * common-name: ** 7-methyl-3-oxooct-6-enoyl-coa * smiles: ** cc(c)=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(...")
(Created page with "Category:metabolite == Metabolite CPD-8621 == * common-name: ** zymostenol * smiles: ** cc(c)cccc([ch]4(c1(c)([ch](c2(=c(cc1)c3(c)([ch](cc2)cc(o)cc3)))cc4)))c * inchi-key:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12897 ==
+
== Metabolite CPD-8621 ==
 
* common-name:
 
* common-name:
** 7-methyl-3-oxooct-6-enoyl-coa
+
** zymostenol
 
* smiles:
 
* smiles:
** cc(c)=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(c)cccc([ch]4(c1(c)([ch](c2(=c(cc1)c3(c)([ch](cc2)cc(o)cc3)))cc4)))c
 
* inchi-key:
 
* inchi-key:
** lpmixvanmseery-fueukbnzsa-j
+
** qetlkndkqoxzrp-xtgbijofsa-n
 
* molecular-weight:
 
* molecular-weight:
** 915.695
+
** 386.66
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11917]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN66-24]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=7-methyl-3-oxooct-6-enoyl-coa}}
+
{{#set: common-name=zymostenol}}
{{#set: inchi-key=inchikey=lpmixvanmseery-fueukbnzsa-j}}
+
{{#set: inchi-key=inchikey=qetlkndkqoxzrp-xtgbijofsa-n}}
{{#set: molecular-weight=915.695}}
+
{{#set: molecular-weight=386.66}}

Revision as of 15:25, 5 January 2021

Metabolite CPD-8621

  • common-name:
    • zymostenol
  • smiles:
    • cc(c)cccc([ch]4(c1(c)([ch](c2(=c(cc1)c3(c)([ch](cc2)cc(o)cc3)))cc4)))c
  • inchi-key:
    • qetlkndkqoxzrp-xtgbijofsa-n
  • molecular-weight:
    • 386.66

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality