Difference between revisions of "CPD-693"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9861 == * common-name: ** 3-demethylubiquinol-7 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(o)c(oc)=c(...")
(Created page with "Category:metabolite == Metabolite biotin-L-lysine-in-BCCP-dimers == * common-name: ** a [biotin carboxyl-carrier-protein dimer]-n6-biotinyl-l-lysine == Reaction(s) known t...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9861 ==
+
== Metabolite biotin-L-lysine-in-BCCP-dimers ==
 
* common-name:
 
* common-name:
** 3-demethylubiquinol-7
+
** a [biotin carboxyl-carrier-protein dimer]-n6-biotinyl-l-lysine
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(o)c(oc)=c(o)c(o)=c(c)1)
 
* inchi-key:
 
** ohbhbmxnjcumcr-dkccahehsa-n
 
* molecular-weight:
 
** 646.992
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9229]]
+
* [[BIOTIN-CARBOXYL-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN0-5055]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-demethylubiquinol-7}}
+
{{#set: common-name=a [biotin carboxyl-carrier-protein dimer]-n6-biotinyl-l-lysine}}
{{#set: inchi-key=inchikey=ohbhbmxnjcumcr-dkccahehsa-n}}
 
{{#set: molecular-weight=646.992}}
 

Revision as of 15:26, 5 January 2021

Metabolite biotin-L-lysine-in-BCCP-dimers

  • common-name:
    • a [biotin carboxyl-carrier-protein dimer]-n6-biotinyl-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [biotin carboxyl-carrier-protein dimer]-n6-biotinyl-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.