Difference between revisions of "S-ubi-N-term-specific-UCP-E2-L-cysteine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite METHYLENE-THF-GLU-N == * common-name: ** a 5,10-methylene-tetrahydrofolate == Reaction(s) known to consume the compound == * 1.5.1.15-R...")
(Created page with "Category:metabolite == Metabolite 2-OCTAPRENYL-6-HYDROXYPHENOL == * common-name: ** 3-(all-trans-octaprenyl)benzene-1,2-diol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite METHYLENE-THF-GLU-N ==
+
== Metabolite 2-OCTAPRENYL-6-HYDROXYPHENOL ==
 
* common-name:
 
* common-name:
** a 5,10-methylene-tetrahydrofolate
+
** 3-(all-trans-octaprenyl)benzene-1,2-diol
 +
* smiles:
 +
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c)c)c
 +
* inchi-key:
 +
** ynpgymzvnlizld-bqfktqoqsa-n
 +
* molecular-weight:
 +
** 655.058
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.5.1.15-RXN]]
+
* [[2-OCTAPRENYL-6-OHPHENOL-METHY-RXN]]
* [[1.5.1.20-RXN]]
 
* [[3-CH3-2-OXOBUTANOATE-OH-CH3-XFER-RXN]]
 
* [[GCVT-RXN]]
 
* [[GLYOHMETRANS-RXN]]
 
* [[METHYLENETHFDEHYDROG-NADP-RXN]]
 
* [[RXN0-2921]]
 
* [[THYMIDYLATESYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3-CH3-2-OXOBUTANOATE-OH-CH3-XFER-RXN]]
+
* [[2-OCTAPRENYLPHENOL-HYDROX-RXN]]
* [[GCVT-RXN]]
 
* [[GLYOHMETRANS-RXN]]
 
* [[METHYLENETHFDEHYDROG-NADP-RXN]]
 
* [[RXN0-2921]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 5,10-methylene-tetrahydrofolate}}
+
{{#set: common-name=3-(all-trans-octaprenyl)benzene-1,2-diol}}
 +
{{#set: inchi-key=inchikey=ynpgymzvnlizld-bqfktqoqsa-n}}
 +
{{#set: molecular-weight=655.058}}

Revision as of 15:26, 5 January 2021

Metabolite 2-OCTAPRENYL-6-HYDROXYPHENOL

  • common-name:
    • 3-(all-trans-octaprenyl)benzene-1,2-diol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c)c)c
  • inchi-key:
    • ynpgymzvnlizld-bqfktqoqsa-n
  • molecular-weight:
    • 655.058

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality