Difference between revisions of "CPD-15666"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14760 == * common-name: ** furfuryl methyl sulfide * smiles: ** cscc1(=cc=co1) * inchi-key: ** sksfhxvdhvkibn-uhfffaoysa-n * molecula...") |
(Created page with "Category:metabolite == Metabolite CPD-11876 == * common-name: ** 3-methoxy-4-hydroxyphenylglycolaldehyde * smiles: ** coc1(=c(o)c=cc(c(o)c=o)=c1) * inchi-key: ** visajvapy...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-11876 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-methoxy-4-hydroxyphenylglycolaldehyde |
* smiles: | * smiles: | ||
| − | ** | + | ** coc1(=c(o)c=cc(c(o)c=o)=c1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** visajvapypfkcl-qmmmgpobsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 182.176 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-10915]] | ||
| + | * [[RXN-10917]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-10910]] |
| + | * [[RXN-10913]] | ||
| + | * [[RXN-10915]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-methoxy-4-hydroxyphenylglycolaldehyde}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=visajvapypfkcl-qmmmgpobsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=182.176}} |
Revision as of 15:27, 5 January 2021
Contents
Metabolite CPD-11876
- common-name:
- 3-methoxy-4-hydroxyphenylglycolaldehyde
- smiles:
- coc1(=c(o)c=cc(c(o)c=o)=c1)
- inchi-key:
- visajvapypfkcl-qmmmgpobsa-n
- molecular-weight:
- 182.176
