Difference between revisions of "CPD-110"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8050 == * common-name: ** scyllo-inositol * smiles: ** c1(c(c(c(c(c1o)o)o)o)o)o * inchi-key: ** cdaismweouebre-cdrysyessa-n * molecul...")
(Created page with "Category:metabolite == Metabolite DADP == * common-name: ** dadp * smiles: ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op([o-])([o-])=o)([o-])=o * inchi-key: ** daeap...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8050 ==
+
== Metabolite DADP ==
 
* common-name:
 
* common-name:
** scyllo-inositol
+
** dadp
 
* smiles:
 
* smiles:
** c1(c(c(c(c(c1o)o)o)o)o)o
+
** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op([o-])([o-])=o)([o-])=o
 
* inchi-key:
 
* inchi-key:
** cdaismweouebre-cdrysyessa-n
+
** daeapnuqqaicnr-rrkcrqdmsa-k
 
* molecular-weight:
 
* molecular-weight:
** 180.157
+
** 408.18
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13779]]
+
* [[DADPKIN-RXN]]
 +
* [[DATPtm]]
 +
* [[NDPK]]
 +
* [[NDPKm]]
 +
* [[RXN-14192]]
 +
* [[RXN-14215]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13779]]
+
* [[ADPREDUCT-RXN]]
 +
* [[ATDAM]]
 +
* [[DAOTO]]
 +
* [[DATCY]]
 +
* [[DATPtm]]
 +
* [[DATUP]]
 +
* [[DEOXYADENYLATE-KINASE-RXN]]
 +
* [[RXN-14214]]
 +
* [[RXN0-747]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=scyllo-inositol}}
+
{{#set: common-name=dadp}}
{{#set: inchi-key=inchikey=cdaismweouebre-cdrysyessa-n}}
+
{{#set: inchi-key=inchikey=daeapnuqqaicnr-rrkcrqdmsa-k}}
{{#set: molecular-weight=180.157}}
+
{{#set: molecular-weight=408.18}}

Revision as of 15:27, 5 January 2021

Metabolite DADP

  • common-name:
    • dadp
  • smiles:
    • c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op([o-])([o-])=o)([o-])=o
  • inchi-key:
    • daeapnuqqaicnr-rrkcrqdmsa-k
  • molecular-weight:
    • 408.18

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality