Difference between revisions of "CPD-694"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SEPO3 == * common-name: ** selenophosphate * smiles: ** [o-]p([o-])(o)=[se] * inchi-key: ** jrphgdyskgjtkz-uhfffaoysa-l * molecular-weigh...")
(Created page with "Category:metabolite == Metabolite CPD-13188 == * common-name: ** β-d-glcp-(1→4)-α-l-rhap-(1→3)-d-glcp * smiles: ** cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SEPO3 ==
+
== Metabolite CPD-13188 ==
 
* common-name:
 
* common-name:
** selenophosphate
+
** β-d-glcp-(1→4)-α-l-rhap-(1→3)-d-glcp
 
* smiles:
 
* smiles:
** [o-]p([o-])(o)=[se]
+
** cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o)c(o)c2oc3(oc(co)c(c(o)c(o)3)o))
 
* inchi-key:
 
* inchi-key:
** jrphgdyskgjtkz-uhfffaoysa-l
+
** cwvrqjbcbctflt-civpzrojsa-n
 
* molecular-weight:
 
* molecular-weight:
** 158.94
+
** 488.442
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10039]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.9.3-RXN]]
+
* [[RXN-12270]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=selenophosphate}}
+
{{#set: common-name=β-d-glcp-(1→4)-α-l-rhap-(1→3)-d-glcp}}
{{#set: inchi-key=inchikey=jrphgdyskgjtkz-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=cwvrqjbcbctflt-civpzrojsa-n}}
{{#set: molecular-weight=158.94}}
+
{{#set: molecular-weight=488.442}}

Revision as of 15:27, 5 January 2021

Metabolite CPD-13188

  • common-name:
    • β-d-glcp-(1→4)-α-l-rhap-(1→3)-d-glcp
  • smiles:
    • cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o)c(o)c2oc3(oc(co)c(c(o)c(o)3)o))
  • inchi-key:
    • cwvrqjbcbctflt-civpzrojsa-n
  • molecular-weight:
    • 488.442

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality