Difference between revisions of "TRNA-Containing-N1-Methylguanine-9"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET == * common-name: ** 2-phospho-4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol * smiles: ** cc...")
(Created page with "Category:metabolite == Metabolite CPD-313 == * common-name: ** propane-1,3-diamine * smiles: ** c(cc[n+])[n+] * inchi-key: ** xfnjvjplkcpibv-uhfffaoysa-p * molecular-weigh...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET ==
+
== Metabolite CPD-313 ==
 
* common-name:
 
* common-name:
** 2-phospho-4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol
+
** propane-1,3-diamine
 
* smiles:
 
* smiles:
** cc(op([o-])([o-])=o)(co)c(o)cop(op([o-])(=o)occ2(c(c(o)c(n1(c(n=c(c=c1)n)=o))o2)o))([o-])=o
+
** c(cc[n+])[n+]
 
* inchi-key:
 
* inchi-key:
** htjxtkbiuvfuar-xhibxcghsa-j
+
** xfnjvjplkcpibv-uhfffaoysa-p
 
* molecular-weight:
 
* molecular-weight:
** 597.259
+
** 76.141
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-302]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.1.148-RXN]]
+
* [[2.5.1.46-RXN]]
 +
* [[RXN-13415]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-phospho-4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol}}
+
{{#set: common-name=propane-1,3-diamine}}
{{#set: inchi-key=inchikey=htjxtkbiuvfuar-xhibxcghsa-j}}
+
{{#set: inchi-key=inchikey=xfnjvjplkcpibv-uhfffaoysa-p}}
{{#set: molecular-weight=597.259}}
+
{{#set: molecular-weight=76.141}}

Revision as of 15:27, 5 January 2021

Metabolite CPD-313

  • common-name:
    • propane-1,3-diamine
  • smiles:
    • c(cc[n+])[n+]
  • inchi-key:
    • xfnjvjplkcpibv-uhfffaoysa-p
  • molecular-weight:
    • 76.141

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality