Difference between revisions of "CPD0-1074"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 7-AMINOMETHYL-7-DEAZAGUANINE == * common-name: ** preq1 * smiles: ** c([n+])c2(c1(c(=o)nc(n)=nc=1nc=2)) * inchi-key: ** meymblgokydglz-uh...") |
(Created page with "Category:metabolite == Metabolite CPD-18890 == * smiles: ** cc=c5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-18890 == |
+ | * smiles: | ||
+ | ** cc=c5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4)=cc5=6)))=cc8(=c(c)c(c(c)=o)=c(n78)c=9)))))) | ||
* common-name: | * common-name: | ||
− | ** | + | ** geranylgeranyl bacteriochlorophyllide b |
− | |||
− | |||
− | |||
− | |||
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 902.447 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-17481]] |
+ | * [[RXN-17483]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-17480]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=geranylgeranyl bacteriochlorophyllide b}} |
− | + | {{#set: molecular-weight=902.447}} | |
− | {{#set: molecular-weight= |
Revision as of 15:27, 5 January 2021
Contents
Metabolite CPD-18890
- smiles:
- cc=c5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4)=cc5=6)))=cc8(=c(c)c(c(c)=o)=c(n78)c=9))))))
- common-name:
- geranylgeranyl bacteriochlorophyllide b
- molecular-weight:
- 902.447