Difference between revisions of "TRNA-adenine-37"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15690 == * common-name: ** (3r)-hydroxy-5-trans-dodecenoyl-coa * smiles: ** ccccccc=ccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(o...")
(Created page with "Category:metabolite == Metabolite CPD-2743 == * common-name: ** nicotine-1'-n-oxide * smiles: ** c1(cc[ch](n(=o)(c)1)c2(=cn=cc=c2)) * inchi-key: ** rwfbqhicrcuqjj-nuhjpdeh...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15690 ==
+
== Metabolite CPD-2743 ==
 
* common-name:
 
* common-name:
** (3r)-hydroxy-5-trans-dodecenoyl-coa
+
** nicotine-1'-n-oxide
 
* smiles:
 
* smiles:
** ccccccc=ccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c1(cc[ch](n(=o)(c)1)c2(=cn=cc=c2))
 
* inchi-key:
 
* inchi-key:
** ayordfmyybnsbo-gkmlisqesa-j
+
** rwfbqhicrcuqjj-nuhjpdehsa-n
 
* molecular-weight:
 
* molecular-weight:
** 959.791
+
** 178.233
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14801]]
+
* [[RXN66-81]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3r)-hydroxy-5-trans-dodecenoyl-coa}}
+
{{#set: common-name=nicotine-1'-n-oxide}}
{{#set: inchi-key=inchikey=ayordfmyybnsbo-gkmlisqesa-j}}
+
{{#set: inchi-key=inchikey=rwfbqhicrcuqjj-nuhjpdehsa-n}}
{{#set: molecular-weight=959.791}}
+
{{#set: molecular-weight=178.233}}

Revision as of 15:28, 5 January 2021

Metabolite CPD-2743

  • common-name:
    • nicotine-1'-n-oxide
  • smiles:
    • c1(cc[ch](n(=o)(c)1)c2(=cn=cc=c2))
  • inchi-key:
    • rwfbqhicrcuqjj-nuhjpdehsa-n
  • molecular-weight:
    • 178.233

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality