Difference between revisions of "CPD-7139"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite COPROPORPHYRINOGEN_III == * common-name: ** coproporphyrinogen iii * smiles: ** cc1(=c2(cc5(=c(c)c(ccc([o-])=o)=c(cc4(=c(ccc([o-])=o)c(c)...")
(Created page with "Category:metabolite == Metabolite Lipoyl-Protein-N6-lipoyllysine == * common-name: ** a [lipoyl-carrier protein]-n6-lipoyl-l-lysine == Reaction(s) known to consume the com...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite COPROPORPHYRINOGEN_III ==
+
== Metabolite Lipoyl-Protein-N6-lipoyllysine ==
 
* common-name:
 
* common-name:
** coproporphyrinogen iii
+
** a [lipoyl-carrier protein]-n6-lipoyl-l-lysine
* smiles:
 
** cc1(=c2(cc5(=c(c)c(ccc([o-])=o)=c(cc4(=c(ccc([o-])=o)c(c)=c(cc3(=c(ccc(=o)[o-])c(c)=c(cc(=c(ccc([o-])=o)1)n2)n3))n4))n5)))
 
* inchi-key:
 
** niuvhxtxuxofeb-uhfffaoysa-j
 
* molecular-weight:
 
** 656.734
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HEMN-RXN]]
 
* [[RXN-17517]]
 
* [[RXN0-1461]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[UROGENDECARBOX-RXN]]
+
* [[1.8.1.4-RXN]]
 +
* [[RXN-17127]]
 +
* [[RXN-8655]]
 +
* [[RXN0-949]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=coproporphyrinogen iii}}
+
{{#set: common-name=a [lipoyl-carrier protein]-n6-lipoyl-l-lysine}}
{{#set: inchi-key=inchikey=niuvhxtxuxofeb-uhfffaoysa-j}}
 
{{#set: molecular-weight=656.734}}
 

Revision as of 15:28, 5 January 2021

Metabolite Lipoyl-Protein-N6-lipoyllysine

  • common-name:
    • a [lipoyl-carrier protein]-n6-lipoyl-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [lipoyl-carrier protein]-n6-lipoyl-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.