Difference between revisions of "CPD-8579"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL == * common-name: ** 5α-cholesta-7,24-dien-3β-ol * smiles: ** cc(c)=cccc(c)[ch]1(cc[ch]3(c...")
(Created page with "Category:metabolite == Metabolite CPD-182 == * common-name: ** 4-methylumbelliferone * smiles: ** cc1(=cc(oc2(c=c(o)c=cc1=2))=o) * inchi-key: ** hshnitrmyyllcv-uhfffaoysa-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL ==
+
== Metabolite CPD-182 ==
 
* common-name:
 
* common-name:
** 5α-cholesta-7,24-dien-3β-ol
+
** 4-methylumbelliferone
 
* smiles:
 
* smiles:
** cc(c)=cccc(c)[ch]1(cc[ch]3(c(c)1cc[ch]2(c4(c)([ch](cc=c23)cc(o)cc4))))
+
** cc1(=cc(oc2(c=c(o)c=cc1=2))=o)
 
* inchi-key:
 
* inchi-key:
** pkeppdggtszlbl-skcnuyalsa-n
+
** hshnitrmyyllcv-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 384.644
+
** 176.171
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11887]]
 
* [[RXN66-321]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-21837]]
+
* [[3.1.1.56-RXN]]
* [[RXN66-320]]
+
* [[RXN-10769]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5α-cholesta-7,24-dien-3β-ol}}
+
{{#set: common-name=4-methylumbelliferone}}
{{#set: inchi-key=inchikey=pkeppdggtszlbl-skcnuyalsa-n}}
+
{{#set: inchi-key=inchikey=hshnitrmyyllcv-uhfffaoysa-n}}
{{#set: molecular-weight=384.644}}
+
{{#set: molecular-weight=176.171}}

Revision as of 15:28, 5 January 2021

Metabolite CPD-182

  • common-name:
    • 4-methylumbelliferone
  • smiles:
    • cc1(=cc(oc2(c=c(o)c=cc1=2))=o)
  • inchi-key:
    • hshnitrmyyllcv-uhfffaoysa-n
  • molecular-weight:
    • 176.171

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality