Difference between revisions of "BIOTIN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8775 == * common-name: ** m-toluate * smiles: ** cc1(=cc(=cc=c1)c(=o)[o-]) * inchi-key: ** gpsduzxpycfosq-uhfffaoysa-m * molecular-we...") |
(Created page with "Category:metabolite == Metabolite CPD-8775 == * common-name: ** m-toluate * smiles: ** cc1(=cc(=cc=c1)c(=o)[o-]) * inchi-key: ** gpsduzxpycfosq-uhfffaoysa-m * molecular-we...") |
(No difference)
|
Revision as of 15:29, 5 January 2021
Contents
Metabolite CPD-8775
- common-name:
- m-toluate
- smiles:
- cc1(=cc(=cc=c1)c(=o)[o-])
- inchi-key:
- gpsduzxpycfosq-uhfffaoysa-m
- molecular-weight:
- 135.142