Difference between revisions of "D-6-P-GLUCONO-DELTA-LACTONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ALPHA-TOCOPHEROL == * common-name: ** α-tocopherol * smiles: ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=c(c(o)=c(c)c(=c(o1)2)c)c)) * inch...")
(Created page with "Category:metabolite == Metabolite L-ORNITHINE == * common-name: ** l-ornithine * smiles: ** c(=o)([o-])c([n+])ccc[n+] * inchi-key: ** ahlphdhhmvztml-bypyzucnsa-o * molecul...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite ALPHA-TOCOPHEROL ==
+
== Metabolite L-ORNITHINE ==
 
* common-name:
 
* common-name:
−
** α-tocopherol
+
** l-ornithine
 
* smiles:
 
* smiles:
−
** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=c(c(o)=c(c)c(=c(o1)2)c)c))
+
** c(=o)([o-])c([n+])ccc[n+]
 
* inchi-key:
 
* inchi-key:
−
** gvjhhuawpyxkbd-ieosbipesa-n
+
** ahlphdhhmvztml-bypyzucnsa-o
 
* molecular-weight:
 
* molecular-weight:
−
** 430.713
+
** 133.17
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ACETYLORNDEACET-RXN]]
 +
* [[ARGINASE-RXN]]
 +
* [[ORDC]]
 +
* [[ORNCARBAMTRANSFER-RXN]]
 +
* [[ORNDECARBOX-RXN]]
 +
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
 +
* [[ORNITHINE-CYCLODEAMINASE-RXN]]
 +
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
 +
* [[RXN-13482]]
 +
* [[biomass_rxn]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[TOCOPHEROL-O-METHYLTRANSFERASE-RXN]]
+
* [[ACETYLORNDEACET-RXN]]
 +
* [[AODAA]]
 +
* [[ARGINASE-RXN]]
 +
* [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]]
 +
* [[ORNCARBAMTRANSFER-RXN]]
 +
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
 +
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
 +
* [[RXN-13482]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=α-tocopherol}}
+
{{#set: common-name=l-ornithine}}
−
{{#set: inchi-key=inchikey=gvjhhuawpyxkbd-ieosbipesa-n}}
+
{{#set: inchi-key=inchikey=ahlphdhhmvztml-bypyzucnsa-o}}
−
{{#set: molecular-weight=430.713}}
+
{{#set: molecular-weight=133.17}}

Revision as of 15:29, 5 January 2021

Metabolite L-ORNITHINE

  • common-name:
    • l-ornithine
  • smiles:
    • c(=o)([o-])c([n+])ccc[n+]
  • inchi-key:
    • ahlphdhhmvztml-bypyzucnsa-o
  • molecular-weight:
    • 133.17

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=D-6-P-GLUCONO-DELTA-LACTONE&oldid=73848"