Difference between revisions of "D-SERINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite N-ACETYL-BETA-GLUCOSAMINYLAMINE == * common-name: ** n-acetyl-β-glucosaminylamine * smiles: ** cc(=o)nc1(c(n)oc(co)c(o)c(o)1) * inch...")
(Created page with "Category:metabolite == Metabolite Cytosine2278-in-25S-rRNA == * common-name: ** a cytosine2278 in 25s rrna == Reaction(s) known to consume the compound == * RXN-15844...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite N-ACETYL-BETA-GLUCOSAMINYLAMINE ==
+
== Metabolite Cytosine2278-in-25S-rRNA ==
 
* common-name:
 
* common-name:
** n-acetyl-β-glucosaminylamine
+
** a cytosine2278 in 25s rrna
* smiles:
 
** cc(=o)nc1(c(n)oc(co)c(o)c(o)1)
 
* inchi-key:
 
** mcgxocxffnkasf-fmdgeedcsa-n
 
* molecular-weight:
 
** 220.225
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-15844]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.5.1.26-RXN]]
 
* [[3.5.1.52-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-acetyl-β-glucosaminylamine}}
+
{{#set: common-name=a cytosine2278 in 25s rrna}}
{{#set: inchi-key=inchikey=mcgxocxffnkasf-fmdgeedcsa-n}}
 
{{#set: molecular-weight=220.225}}
 

Revision as of 15:29, 5 January 2021

Metabolite Cytosine2278-in-25S-rRNA

  • common-name:
    • a cytosine2278 in 25s rrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality