Difference between revisions of "MYRICETIN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14795 == * common-name: ** udp-n-acetyl-α-d-galactosamine * smiles: ** cc(nc3(c(op(op(occ1(c(c(c(o1)n2(c=cc(nc2=o)=o))o)o))([o-...") |
(Created page with "Category:metabolite == Metabolite CPD-1086 == * common-name: ** 5-amino-6-(5-phospho-d-ribitylamino)uracil * smiles: ** c(nc1(nc(nc(=o)c(n)=1)=o))c(o)c(o)c(o)cop([o-])(=o)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-1086 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5-amino-6-(5-phospho-d-ribitylamino)uracil |
* smiles: | * smiles: | ||
| − | ** | + | ** c(nc1(nc(nc(=o)c(n)=1)=o))c(o)c(o)c(o)cop([o-])(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** rqrinyisxyazkl-rpdrrwsusa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 354.213 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RIBOFLAVINSYNREDUC-RXN]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5-amino-6-(5-phospho-d-ribitylamino)uracil}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rqrinyisxyazkl-rpdrrwsusa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=354.213}} |
Revision as of 15:29, 5 January 2021
Contents
Metabolite CPD-1086
- common-name:
- 5-amino-6-(5-phospho-d-ribitylamino)uracil
- smiles:
- c(nc1(nc(nc(=o)c(n)=1)=o))c(o)c(o)c(o)cop([o-])(=o)[o-]
- inchi-key:
- rqrinyisxyazkl-rpdrrwsusa-l
- molecular-weight:
- 354.213
