Difference between revisions of "CPD-16551"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CMP == * common-name: ** cmp * smiles: ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op([o-])([o-])=o * inchi-key: ** ierhlvcpsmictf-xvfcmesi...") |
(Created page with "Category:metabolite == Metabolite tRNAs-with-queuine == * common-name: ** a queuosine34 in trna == Reaction(s) known to consume the compound == == Reaction(s) known to pro...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite tRNAs-with-queuine == |
* common-name: | * common-name: | ||
− | ** | + | ** a queuosine34 in trna |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | + | * [[QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN]] | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a queuosine34 in trna}} |
− | |||
− |
Revision as of 15:29, 5 January 2021
Contents
Metabolite tRNAs-with-queuine
- common-name:
- a queuosine34 in trna