Difference between revisions of "R-3-hydroxylignoceroyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12826 == * common-name: ** folate * smiles: ** c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c2(c=nc3(n=c(n)nc(=o)c(n=2)=3)) * inch...") |
(Created page with "Category:metabolite == Metabolite tRNA-uridine-38-39 == * common-name: ** a uridine38/39 in trna == Reaction(s) known to consume the compound == * RXN-12727 == Reactio...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite tRNA-uridine-38-39 == |
* common-name: | * common-name: | ||
− | ** | + | ** a uridine38/39 in trna |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-12727]] |
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-12727]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a uridine38/39 in trna}} |
− | |||
− |
Revision as of 15:30, 5 January 2021
Contents
Metabolite tRNA-uridine-38-39
- common-name:
- a uridine38/39 in trna