Difference between revisions of "Crotonyl-ACPs"

Revision as of 15:30, 5 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CAFFEOYL-COA ==
+== Metabolite PHOSPHORYL-CHOLINE ==
 * common-name:
-** trans-caffeoyl-coa
+** phosphocholine
 * smiles:
-** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=c(o)c(=c1)o))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
+** c[n+](ccop([o-])([o-])=o)(c)c
 * inchi-key:
-** qhrgjmimhclhrg-zseliehesa-j
+** yhhsonzfoiemcp-uhfffaoysa-m
 * molecular-weight:
-** 925.647
+** 182.136
 == Reaction(s) known to consume the compound ==
-* [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]]
+* [[2.7.7.15-RXN]]
+* [[CHLPCTDh]]
+* [[RXN-5647]]
+* [[RXN-9614]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-1126]]
+* [[CHOLINE-KINASE-RXN]]
+* [[PHOSPHOLIPASE-C-RXN]]
+* [[RXN-15212]]
+* [[RXN-9614]]
+* [[SPHINGOMYELIN-PHOSPHODIESTERASE-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=trans-caffeoyl-coa}}
+{{#set: common-name=phosphocholine}}
-{{#set: inchi-key=inchikey=qhrgjmimhclhrg-zseliehesa-j}}
+{{#set: inchi-key=inchikey=yhhsonzfoiemcp-uhfffaoysa-m}}
-{{#set: molecular-weight=925.647}}
+{{#set: molecular-weight=182.136}}