Difference between revisions of "RNA-Ligase-L-lysine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Ubiquinols == * common-name: ** an ubiquinol == Reaction(s) known to consume the compound == * 1.10.2.2-RXN * 1.5.5.1-RXN * NAD...") |
(Created page with "Category:metabolite == Metabolite CPD-10244 == * common-name: ** docosahexaenoate * smiles: ** ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)[o-] * inchi-key: ** mbmbgcfofbjsgt-kubavdmb...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-10244 == |
* common-name: | * common-name: | ||
− | ** | + | ** docosahexaenoate |
+ | * smiles: | ||
+ | ** ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)[o-] | ||
+ | * inchi-key: | ||
+ | ** mbmbgcfofbjsgt-kubavdmbsa-m | ||
+ | * molecular-weight: | ||
+ | ** 327.486 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[RXN-16063]] | |
− | |||
− | |||
− | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-16017]] |
− | + | * [[RXN-16063]] | |
− | + | * [[RXN-16138]] | |
− | * [[RXN- | ||
− | * [[RXN- | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=docosahexaenoate}} |
+ | {{#set: inchi-key=inchikey=mbmbgcfofbjsgt-kubavdmbsa-m}} | ||
+ | {{#set: molecular-weight=327.486}} |
Revision as of 15:30, 5 January 2021
Contents
Metabolite CPD-10244
- common-name:
- docosahexaenoate
- smiles:
- ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)[o-]
- inchi-key:
- mbmbgcfofbjsgt-kubavdmbsa-m
- molecular-weight:
- 327.486