Difference between revisions of "TRP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-787 == * common-name: ** (2z,4z)-2-hydroxyhepta-2,4-dienedioate * smiles: ** c([o-])(=o)cc=cc=c(o)c(=o)[o-] * inchi-key: ** zbcbetmbs...")
(Created page with "Category:metabolite == Metabolite STEAROYL-COA == * common-name: ** stearoyl-coa * smiles: ** cccccccccccccccccc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-787 ==
+
== Metabolite STEAROYL-COA ==
 
* common-name:
 
* common-name:
** (2z,4z)-2-hydroxyhepta-2,4-dienedioate
+
** stearoyl-coa
 
* smiles:
 
* smiles:
** c([o-])(=o)cc=cc=c(o)c(=o)[o-]
+
** cccccccccccccccccc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
 
* inchi-key:
 
* inchi-key:
** zbcbetmbsdtinl-nwjcxacmsa-l
+
** siarjekbadxqjg-lfzquhgesa-j
 
* molecular-weight:
 
* molecular-weight:
** 170.121
+
** 1029.968
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN1K-87]]
+
* [[1.14.19.1-RXN]]
 +
* [[2-ACYLGLYCEROL-O-ACYLTRANSFERASE-RXN-CPD66-43/STEAROYL-COA//CPD-17271/CO-A.38.]]
 +
* [[RXN-13294]]
 +
* [[RXN-9624]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2-ACYLGLYCEROL-O-ACYLTRANSFERASE-RXN-CPD66-43/STEAROYL-COA//CPD-17271/CO-A.38.]]
 +
* [[RXN-16380]]
 +
* [[RXN3O-5304]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2z,4z)-2-hydroxyhepta-2,4-dienedioate}}
+
{{#set: common-name=stearoyl-coa}}
{{#set: inchi-key=inchikey=zbcbetmbsdtinl-nwjcxacmsa-l}}
+
{{#set: inchi-key=inchikey=siarjekbadxqjg-lfzquhgesa-j}}
{{#set: molecular-weight=170.121}}
+
{{#set: molecular-weight=1029.968}}

Revision as of 15:30, 5 January 2021

Metabolite STEAROYL-COA

  • common-name:
    • stearoyl-coa
  • smiles:
    • cccccccccccccccccc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
  • inchi-key:
    • siarjekbadxqjg-lfzquhgesa-j
  • molecular-weight:
    • 1029.968

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality