Difference between revisions of "CPD-15016"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11407 == * common-name: ** thyroxine sulfate * smiles: ** c2(c(i)=c(oc1(c=c(c(os(=o)(=o)[o-])=c(c=1)i)i))c(=cc=2cc(c(=o)[o-])[n+])i)...")
(Created page with "Category:metabolite == Metabolite D-MYO-INOSITOL-4-PHOSPHATE == * common-name: ** 1d-myo-inositol 4-monophosphate * smiles: ** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11407 ==
+
== Metabolite D-MYO-INOSITOL-4-PHOSPHATE ==
 
* common-name:
 
* common-name:
** thyroxine sulfate
+
** 1d-myo-inositol 4-monophosphate
 
* smiles:
 
* smiles:
** c2(c(i)=c(oc1(c=c(c(os(=o)(=o)[o-])=c(c=1)i)i))c(=cc=2cc(c(=o)[o-])[n+])i)
+
** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1)
 
* inchi-key:
 
* inchi-key:
** qyxijuzwssqict-lbprgkrzsa-m
+
** inapmgsxuvuwaf-cnwjwelysa-l
 
* molecular-weight:
 
* molecular-weight:
** 855.924
+
** 258.121
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-10952]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10614]]
+
* [[3.1.3.57-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=thyroxine sulfate}}
+
{{#set: common-name=1d-myo-inositol 4-monophosphate}}
{{#set: inchi-key=inchikey=qyxijuzwssqict-lbprgkrzsa-m}}
+
{{#set: inchi-key=inchikey=inapmgsxuvuwaf-cnwjwelysa-l}}
{{#set: molecular-weight=855.924}}
+
{{#set: molecular-weight=258.121}}

Revision as of 15:31, 5 January 2021

Metabolite D-MYO-INOSITOL-4-PHOSPHATE

  • common-name:
    • 1d-myo-inositol 4-monophosphate
  • smiles:
    • c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1)
  • inchi-key:
    • inapmgsxuvuwaf-cnwjwelysa-l
  • molecular-weight:
    • 258.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality