Difference between revisions of "HISDEG-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-591 CPD-591] == * common-name: ** cyanidin * smiles: ** c3(c(c1(c(=cc2(=c([o-])c=c(o)c=c([o...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-24-DINITROPHENYLGLUTATHIONE S-24-DINITROPHENYLGLUTATHIONE] == * common-name: ** 2,4-dinitroph...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-591 CPD-591] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-24-DINITROPHENYLGLUTATHIONE S-24-DINITROPHENYLGLUTATHIONE] ==
 
* common-name:
 
* common-name:
** cyanidin
+
** 2,4-dinitrophenyl-s-glutathione
 
* smiles:
 
* smiles:
** c3(c(c1(c(=cc2(=c([o-])c=c(o)c=c([o+]=1)2))[o-]))=cc(o)=c(c=3)o)
+
** c(=o)([o-])cnc(=o)c(nc(=o)ccc([n+])c(=o)[o-])csc1(c=cc([n+]([o-])=o)=cc([n+]([o-])=o)=1)
 
* inchi-key:
 
* inchi-key:
** vevzsmaejfvwil-uhfffaoysa-m
+
** fxeukvkgtkddiq-uwvggrqhsa-m
 
* molecular-weight:
 
* molecular-weight:
** 285.232
+
** 472.406
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9725]]
+
* [[GST-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[GST-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cyanidin}}
+
{{#set: common-name=2,4-dinitrophenyl-s-glutathione}}
{{#set: inchi-key=inchikey=vevzsmaejfvwil-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=fxeukvkgtkddiq-uwvggrqhsa-m}}
{{#set: molecular-weight=285.232}}
+
{{#set: molecular-weight=472.406}}

Revision as of 14:18, 26 August 2019

Metabolite S-24-DINITROPHENYLGLUTATHIONE

  • common-name:
    • 2,4-dinitrophenyl-s-glutathione
  • smiles:
    • c(=o)([o-])cnc(=o)c(nc(=o)ccc([n+])c(=o)[o-])csc1(c=cc([n+]([o-])=o)=cc([n+]([o-])=o)=1)
  • inchi-key:
    • fxeukvkgtkddiq-uwvggrqhsa-m
  • molecular-weight:
    • 472.406

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality