Difference between revisions of "CPD-678"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDRO-NEO-PTERIN == * common-name: ** 7,8-dihydroneopterin * smiles: ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2)) * inchi-key: ** yqifam...")
(Created page with "Category:metabolite == Metabolite CPD-12699 == * common-name: ** (2r)-2-hydroxy-2-methylbutanenitrile * smiles: ** ccc(c)(o)c#n * inchi-key: ** vmehotodtpxckt-yfkpbyrvsa-n...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DIHYDRO-NEO-PTERIN ==
+
== Metabolite CPD-12699 ==
 
* common-name:
 
* common-name:
** 7,8-dihydroneopterin
+
** (2r)-2-hydroxy-2-methylbutanenitrile
 
* smiles:
 
* smiles:
** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2))
+
** ccc(c)(o)c#n
 
* inchi-key:
 
* inchi-key:
** yqifamynggotfb-xinawcovsa-n
+
** vmehotodtpxckt-yfkpbyrvsa-n
 
* molecular-weight:
 
* molecular-weight:
** 255.233
+
** 99.132
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[H2NEOPTERINALDOL-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN]]
+
* [[RXN-9674]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=7,8-dihydroneopterin}}
+
{{#set: common-name=(2r)-2-hydroxy-2-methylbutanenitrile}}
{{#set: inchi-key=inchikey=yqifamynggotfb-xinawcovsa-n}}
+
{{#set: inchi-key=inchikey=vmehotodtpxckt-yfkpbyrvsa-n}}
{{#set: molecular-weight=255.233}}
+
{{#set: molecular-weight=99.132}}

Revision as of 13:07, 14 January 2021

Metabolite CPD-12699

  • common-name:
    • (2r)-2-hydroxy-2-methylbutanenitrile
  • smiles:
    • ccc(c)(o)c#n
  • inchi-key:
    • vmehotodtpxckt-yfkpbyrvsa-n
  • molecular-weight:
    • 99.132

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality