Difference between revisions of "CPD-10260"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Red-Glutaredoxins == * common-name: ** a reduced glutaredoxin == Reaction(s) known to consume the compound == * RXN-982 == Reaction(s...") |
(Created page with "Category:metabolite == Metabolite SINAPATE == * common-name: ** sinapate * smiles: ** coc1(c=c(c=c(oc)c(o)=1)c=cc([o-])=o) * inchi-key: ** pcmortlopmlefb-onegzznksa-m * mo...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite SINAPATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** sinapate |
| + | * smiles: | ||
| + | ** coc1(c=c(c=c(oc)c(o)=1)c=cc([o-])=o) | ||
| + | * inchi-key: | ||
| + | ** pcmortlopmlefb-onegzznksa-m | ||
| + | * molecular-weight: | ||
| + | ** 223.205 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-10919]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-3422]] | ||
| + | * [[RXN-8014]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=sinapate}} |
| + | {{#set: inchi-key=inchikey=pcmortlopmlefb-onegzznksa-m}} | ||
| + | {{#set: molecular-weight=223.205}} | ||
Revision as of 13:07, 14 January 2021
Contents
Metabolite SINAPATE
- common-name:
- sinapate
- smiles:
- coc1(c=c(c=c(oc)c(o)=1)c=cc([o-])=o)
- inchi-key:
- pcmortlopmlefb-onegzznksa-m
- molecular-weight:
- 223.205
