Difference between revisions of "CPD-10712"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SIROHYDROCHLORIN == * common-name: ** sirohydrochlorin * smiles: ** cc2(cc(=o)[o-])(c1(=cc5(=nc(=cc4(nc(c=c3(n=c(c=c(n1)c(ccc(=o)[o-])2)c...")
(Created page with "Category:metabolite == Metabolite Enoylpimeloyl-ACP-methyl-esters == * common-name: ** an enoylpimeloyl-[acp] methyl ester == Reaction(s) known to consume the compound ==...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SIROHYDROCHLORIN ==
+
== Metabolite Enoylpimeloyl-ACP-methyl-esters ==
 
* common-name:
 
* common-name:
** sirohydrochlorin
+
** an enoylpimeloyl-[acp] methyl ester
* smiles:
 
** cc2(cc(=o)[o-])(c1(=cc5(=nc(=cc4(nc(c=c3(n=c(c=c(n1)c(ccc(=o)[o-])2)c(cc(=o)[o-])=c(ccc(=o)[o-])3))=c(ccc(=o)[o-])c(cc(=o)[o-])=4))c(c)(cc(=o)[o-])c(ccc(=o)[o-])5)))
 
* inchi-key:
 
** kwizrxmmfrbuml-ahgfgahvsa-f
 
* molecular-weight:
 
** 854.779
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[4.99.1.3-RXN]]
+
* [[RXN-11482]]
* [[SIROHEME-FERROCHELAT-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DIMETHUROPORDEHYDROG-RXN]]
+
* [[RXN-11481]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=sirohydrochlorin}}
+
{{#set: common-name=an enoylpimeloyl-[acp] methyl ester}}
{{#set: inchi-key=inchikey=kwizrxmmfrbuml-ahgfgahvsa-f}}
 
{{#set: molecular-weight=854.779}}
 

Revision as of 13:07, 14 January 2021

Metabolite Enoylpimeloyl-ACP-methyl-esters

  • common-name:
    • an enoylpimeloyl-[acp] methyl ester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an enoylpimeloyl-[acp] methyl ester" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.