Difference between revisions of "N-formyl-L-methionyl-tRNAfmet"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7088 == * common-name: ** (2r,3s,4s)-leucodelphinidin * smiles: ** c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc(o)=c(c(o)=3)o) * inchi-ke...") |
(Created page with "Category:metabolite == Metabolite D-LACTATE == * common-name: ** (r)-lactate * smiles: ** cc(c([o-])=o)o * inchi-key: ** jvtaaekczfnvcj-uwtatzphsa-m * molecular-weight: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite D-LACTATE == |
* common-name: | * common-name: | ||
| − | ** ( | + | ** (r)-lactate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c([o-])=o)o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** jvtaaekczfnvcj-uwtatzphsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 89.071 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[D-LACTATE-DEHYDROGENASE-CYTOCHROME-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[DLACTDEHYDROGNAD-RXN]] |
| + | * [[GLYOXII-RXN]] | ||
| + | * [[GLYOXIII-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=( | + | {{#set: common-name=(r)-lactate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jvtaaekczfnvcj-uwtatzphsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=89.071}} |
Revision as of 13:08, 14 January 2021
Contents
Metabolite D-LACTATE
- common-name:
- (r)-lactate
- smiles:
- cc(c([o-])=o)o
- inchi-key:
- jvtaaekczfnvcj-uwtatzphsa-m
- molecular-weight:
- 89.071
