Difference between revisions of "B-ALANINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-659 == * common-name: ** l-arogenate * smiles: ** c(c(cc1(c=cc(c=c1)o)c([o-])=o)[n+])([o-])=o * inchi-key: ** mieildywganznh-dsquftab...")
(Created page with "Category:metabolite == Metabolite DNA-Guanines == * common-name: ** a guanine in dna == Reaction(s) known to consume the compound == == Reaction(s) known to produce the co...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-659 ==
+
== Metabolite DNA-Guanines ==
 
* common-name:
 
* common-name:
** l-arogenate
+
** a guanine in dna
* smiles:
 
** c(c(cc1(c=cc(c=c1)o)c([o-])=o)[n+])([o-])=o
 
* inchi-key:
 
** mieildywganznh-dsquftabsa-m
 
* molecular-weight:
 
** 226.208
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
 
* [[PREPHENATE-TRANSAMINE-RXN]]
 
* [[RXN-5682]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
+
* [[2.1.1.63-RXN]]
* [[PREPHENATE-TRANSAMINE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-arogenate}}
+
{{#set: common-name=a guanine in dna}}
{{#set: inchi-key=inchikey=mieildywganznh-dsquftabsa-m}}
 
{{#set: molecular-weight=226.208}}
 

Revision as of 13:08, 14 January 2021

Metabolite DNA-Guanines

  • common-name:
    • a guanine in dna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality