Difference between revisions of "HEXANOYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Glycerolipid-crepenynate == * common-name: ** a [glycerolipid]-crepenynate == Reaction(s) known to consume the compound == == Reaction(s)...")
(Created page with "Category:metabolite == Metabolite CPD-15692 == * common-name: ** (3e)-dec-3-enoyl-coa * smiles: ** ccccccc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Glycerolipid-crepenynate ==
+
== Metabolite CPD-15692 ==
 
* common-name:
 
* common-name:
** a [glycerolipid]-crepenynate
+
** (3e)-dec-3-enoyl-coa
 +
* smiles:
 +
** ccccccc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** cqgvnmqhzqjnii-zjzqahhtsa-j
 +
* molecular-weight:
 +
** 915.738
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.14.99.33-RXN]]
+
* [[RXN-14803]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [glycerolipid]-crepenynate}}
+
{{#set: common-name=(3e)-dec-3-enoyl-coa}}
 +
{{#set: inchi-key=inchikey=cqgvnmqhzqjnii-zjzqahhtsa-j}}
 +
{{#set: molecular-weight=915.738}}

Revision as of 13:08, 14 January 2021

Metabolite CPD-15692

  • common-name:
    • (3e)-dec-3-enoyl-coa
  • smiles:
    • ccccccc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • cqgvnmqhzqjnii-zjzqahhtsa-j
  • molecular-weight:
    • 915.738

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality