Difference between revisions of "N-Ac-L-methionyl-L-glutaminyl-Protein"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite D-ERYTHRO-IMIDAZOLE-GLYCEROL-P == * common-name: ** d-erythro-imidazole-glycerol-phosphate * smiles: ** c1(nc=nc=1c(c(o)cop(=o)([o-])[o-]...") |
(Created page with "Category:metabolite == Metabolite CPD-11715 == * common-name: ** phenylacetylglycine * smiles: ** c(=o)(ncc(=o)[o-])cc1(c=cc=cc=1) * inchi-key: ** utyvdvlmyqplqb-uhfffaoys...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-11715 == |
* common-name: | * common-name: | ||
| − | ** | + | ** phenylacetylglycine |
* smiles: | * smiles: | ||
| − | ** | + | ** c(=o)(ncc(=o)[o-])cc1(c=cc=cc=1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** utyvdvlmyqplqb-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 192.194 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-10821]] | |
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=phenylacetylglycine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=utyvdvlmyqplqb-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=192.194}} |
Revision as of 13:08, 14 January 2021
Contents
Metabolite CPD-11715
- common-name:
- phenylacetylglycine
- smiles:
- c(=o)(ncc(=o)[o-])cc1(c=cc=cc=1)
- inchi-key:
- utyvdvlmyqplqb-uhfffaoysa-m
- molecular-weight:
- 192.194
