Difference between revisions of "CPD-13025"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite LL-DIAMINOPIMELATE == * common-name: ** l,l-diaminopimelate * smiles: ** c(c(cccc(c([o-])=o)[n+])[n+])([o-])=o * inchi-key: ** gmkmezvlhj...") |
(Created page with "Category:metabolite == Metabolite 1-183-2-183-SN-GLYCEROL-PHOSPHOCHOLINE == * common-name: ** 1-α-linolenoyl-2-α-linolenoyl-phosphatidylcholine * smiles: ** cc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 1-183-2-183-SN-GLYCEROL-PHOSPHOCHOLINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-α-linolenoyl-2-α-linolenoyl-phosphatidylcholine |
* smiles: | * smiles: | ||
| − | ** | + | ** ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc=ccc=ccc)cop([o-])(=o)occ[n+](c)(c)c)=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xxkfqtjojzelmd-jicbsjgisa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 778.06 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-8325]] |
| − | * [[RXN- | + | * [[RXN-8331]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-α-linolenoyl-2-α-linolenoyl-phosphatidylcholine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xxkfqtjojzelmd-jicbsjgisa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=778.06}} |
Revision as of 13:08, 14 January 2021
Contents
Metabolite 1-183-2-183-SN-GLYCEROL-PHOSPHOCHOLINE
- common-name:
- 1-α-linolenoyl-2-α-linolenoyl-phosphatidylcholine
- smiles:
- ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc=ccc=ccc)cop([o-])(=o)occ[n+](c)(c)c)=o
- inchi-key:
- xxkfqtjojzelmd-jicbsjgisa-n
- molecular-weight:
- 778.06
