Difference between revisions of "PHYTOSPINGOSINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18532 == * common-name: ** (r)-β-hydroxy-l-kynurenine * smiles: ** c([o-])(=o)c([n+])c(o)c(=o)c1(=c(n)c=cc=c1) * inchi-key: ** m...")
(Created page with "Category:metabolite == Metabolite CPD-14717 == * common-name: ** (r)-2-hydroxy-stearoyl-coa * smiles: ** ccccccccccccccccc(o)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-18532 ==
+
== Metabolite CPD-14717 ==
 
* common-name:
 
* common-name:
** (r)-β-hydroxy-l-kynurenine
+
** (r)-2-hydroxy-stearoyl-coa
 
* smiles:
 
* smiles:
** c([o-])(=o)c([n+])c(o)c(=o)c1(=c(n)c=cc=c1)
+
** ccccccccccccccccc(o)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** memllrtvgbiljw-ionnqarksa-n
+
** ojqmixcijflult-mxqbtarfsa-j
 
* molecular-weight:
 
* molecular-weight:
** 224.216
+
** 1045.968
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ACECOATRANS-RXN-CPD-14717/ACET//R-2-HYDROXYSTEARATE/ACETYL-COA.47.]]
 +
* [[RXN66-475-CPD-14717//CPD-14719/FORMYL-COA.32.]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17150]]
+
* [[RXN66-474-R-2-HYDROXYSTEARATE/ATP/CO-A//CPD-14717/AMP/PPI.48.]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(r)-β-hydroxy-l-kynurenine}}
+
{{#set: common-name=(r)-2-hydroxy-stearoyl-coa}}
{{#set: inchi-key=inchikey=memllrtvgbiljw-ionnqarksa-n}}
+
{{#set: inchi-key=inchikey=ojqmixcijflult-mxqbtarfsa-j}}
{{#set: molecular-weight=224.216}}
+
{{#set: molecular-weight=1045.968}}

Revision as of 13:08, 14 January 2021

Metabolite CPD-14717

  • common-name:
    • (r)-2-hydroxy-stearoyl-coa
  • smiles:
    • ccccccccccccccccc(o)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • ojqmixcijflult-mxqbtarfsa-j
  • molecular-weight:
    • 1045.968

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality