Difference between revisions of "N-4-aminobutylidene-enzyme-lysine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15280 == * common-name: ** hercynine * smiles: ** c[n+](c)(c)c(cc1(=cnc=n1))c(=o)[o-] * inchi-key: ** gppytcrvkhuljh-qmmmgpobsa-n * m...")
(Created page with "Category:metabolite == Metabolite CPD-171 == * common-name: ** a dolichyl β-d-mannosyl phosphate == Reaction(s) known to consume the compound == * 2.4.1.109-RXN *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15280 ==
+
== Metabolite CPD-171 ==
 
* common-name:
 
* common-name:
** hercynine
+
** a dolichyl β-d-mannosyl phosphate
* smiles:
 
** c[n+](c)(c)c(cc1(=cnc=n1))c(=o)[o-]
 
* inchi-key:
 
** gppytcrvkhuljh-qmmmgpobsa-n
 
* molecular-weight:
 
** 197.236
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14430]]
+
* [[2.4.1.109-RXN]]
 +
* [[RXN-5466]]
 +
* [[RXN-5467]]
 +
* [[RXN-5468]]
 +
* [[RXN-5469]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2.4.1.83-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=hercynine}}
+
{{#set: common-name=a dolichyl β-d-mannosyl phosphate}}
{{#set: inchi-key=inchikey=gppytcrvkhuljh-qmmmgpobsa-n}}
 
{{#set: molecular-weight=197.236}}
 

Revision as of 13:08, 14 January 2021

Metabolite CPD-171

  • common-name:
    • a dolichyl β-d-mannosyl phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality