Difference between revisions of "CPD-208"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-510 == * common-name: ** α-d-glucuronate 1-phosphate * smiles: ** c(c1(oc(c(c(c1o)o)o)op([o-])([o-])=o))([o-])=o * inchi-key: *...") |
(Created page with "Category:metabolite == Metabolite Beta-adrenergic-receptors-P == * common-name: ** a phosphorylated β-adrenergic receptor == Reaction(s) known to consume the compound...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Beta-adrenergic-receptors-P == |
* common-name: | * common-name: | ||
| − | ** & | + | ** a phosphorylated β-adrenergic receptor |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[2.7. | + | * [[2.7.11.15-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[2.7. | + | * [[2.7.11.15-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=& | + | {{#set: common-name=a phosphorylated β-adrenergic receptor}} |
| − | |||
| − | |||
Revision as of 13:08, 14 January 2021
Contents
Metabolite Beta-adrenergic-receptors-P
- common-name:
- a phosphorylated β-adrenergic receptor
