Difference between revisions of "5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE == * common-name: ** 5-amino-1-(5-phospho-β-d-ribosyl)imidazole * smiles: ** c2([n+]=cn(c1(oc(cop(...") |
(Created page with "Category:metabolite == Metabolite CPD-13187 == * common-name: ** unsaturated gellan tetrasaccharide * smiles: ** cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o)c(o)c2oc3(oc(co)c(c(o)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-13187 == |
* common-name: | * common-name: | ||
| − | ** | + | ** unsaturated gellan tetrasaccharide |
* smiles: | * smiles: | ||
| − | ** | + | ** cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o)c(o)c2oc3(oc(co)c(c(o)c(o)3)oc4(oc(c([o-])=o)=cc(o)c(o)4))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** jmdplhpaglyhci-pqvubfrasa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 645.544 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-12270]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=unsaturated gellan tetrasaccharide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jmdplhpaglyhci-pqvubfrasa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=645.544}} |
Revision as of 13:08, 14 January 2021
Contents
Metabolite CPD-13187
- common-name:
- unsaturated gellan tetrasaccharide
- smiles:
- cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o)c(o)c2oc3(oc(co)c(c(o)c(o)3)oc4(oc(c([o-])=o)=cc(o)c(o)4)))
- inchi-key:
- jmdplhpaglyhci-pqvubfrasa-m
- molecular-weight:
- 645.544
