Difference between revisions of "CPD-728"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7418 == * common-name: ** coumarinate * smiles: ** c(c=cc1(=c(c=cc=c1)o))(=o)[o-] * inchi-key: ** pmowtihvnwzyfi-waywqwqtsa-m * molec...") |
(Created page with "Category:metabolite == Metabolite Long-Chain-oxoacyl-CoAs == * common-name: ** a long-chain 3-oxoacyl-coa == Reaction(s) known to consume the compound == * 1.1.1.211-RXN...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Long-Chain-oxoacyl-CoAs == |
* common-name: | * common-name: | ||
| − | ** | + | ** a long-chain 3-oxoacyl-coa |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[1.1.1.211-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[1.1.1.211-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a long-chain 3-oxoacyl-coa}} |
| − | |||
| − | |||
Revision as of 13:08, 14 January 2021
Contents
Metabolite Long-Chain-oxoacyl-CoAs
- common-name:
- a long-chain 3-oxoacyl-coa
