Difference between revisions of "Fatty-Aldehydes"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Charged-TRP-tRNAs == * common-name: ** an l-tryptophanyl-[trnatrp] == Reaction(s) known to consume the compound == == Reaction(s) known t...") |
(Created page with "Category:metabolite == Metabolite HOMO-I-CIT == * common-name: ** (1r,2s)-homoisocitrate * smiles: ** c(cc(=o)[o-])c(c(=o)[o-])c(o)c(=o)[o-] * inchi-key: ** oejzzcgrgvfwhk...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite HOMO-I-CIT == |
* common-name: | * common-name: | ||
| − | ** | + | ** (1r,2s)-homoisocitrate |
| + | * smiles: | ||
| + | ** c(cc(=o)[o-])c(c(=o)[o-])c(o)c(=o)[o-] | ||
| + | * inchi-key: | ||
| + | ** oejzzcgrgvfwhk-wvzvxsggsa-k | ||
| + | * molecular-weight: | ||
| + | ** 203.128 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[HOMOACONITATE-HYDRATASE-RXN]] | ||
| + | * [[RXN-13722]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[HOMOACONITATE-HYDRATASE-RXN]] |
| + | * [[RXN-13722]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(1r,2s)-homoisocitrate}} |
| + | {{#set: inchi-key=inchikey=oejzzcgrgvfwhk-wvzvxsggsa-k}} | ||
| + | {{#set: molecular-weight=203.128}} | ||
Revision as of 13:09, 14 January 2021
Contents
Metabolite HOMO-I-CIT
- common-name:
- (1r,2s)-homoisocitrate
- smiles:
- c(cc(=o)[o-])c(c(=o)[o-])c(o)c(=o)[o-]
- inchi-key:
- oejzzcgrgvfwhk-wvzvxsggsa-k
- molecular-weight:
- 203.128
