Difference between revisions of "Oxidized-cytochromes-c551"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-5662 == * common-name: ** 9-mercaptodethiobiotin * smiles: ** c(s)c1(c(nc(n1)=o)cccccc(=o)[o-]) * inchi-key: ** zarfdbykhcotrh-uhfffa...") |
(Created page with "Category:metabolite == Metabolite S-COCLAURINE == * common-name: ** (s)-coclaurine * smiles: ** c1([n+][ch](c2(c(c1)=cc(=c(c=2)o)oc))cc3(=cc=c(c=c3)o)) * inchi-key: ** lvv...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite S-COCLAURINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** (s)-coclaurine |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c1([n+][ch](c2(c(c1)=cc(=c(c=2)o)oc))cc3(=cc=c(c=c3)o)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** lvvkxrqzsruvpy-hnnxbmfysa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 286.35 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[2.1.1.140-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[2.1.1.128-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(s)-coclaurine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=lvvkxrqzsruvpy-hnnxbmfysa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=286.35}} |
Revision as of 13:09, 14 January 2021
Contents
Metabolite S-COCLAURINE
- common-name:
- (s)-coclaurine
- smiles:
- c1([n+][ch](c2(c(c1)=cc(=c(c=2)o)oc))cc3(=cc=c(c=c3)o))
- inchi-key:
- lvvkxrqzsruvpy-hnnxbmfysa-o
- molecular-weight:
- 286.35
