Difference between revisions of "N-terminal-asparagine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14392 == * common-name: ** stearidonoyl-coa * smiles: ** ccc=ccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(...")
(Created page with "Category:metabolite == Metabolite CPD-9446 == * common-name: ** 1,5-anhydro-d-mannitol * smiles: ** c(o)c1(occ(o)c(o)c(o)1) * inchi-key: ** mpcajmnynogxpb-kvtdhhqdsa-n * m...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14392 ==
+
== Metabolite CPD-9446 ==
 
* common-name:
 
* common-name:
** stearidonoyl-coa
+
** 1,5-anhydro-d-mannitol
 
* smiles:
 
* smiles:
** ccc=ccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c(o)c1(occ(o)c(o)c(o)1)
 
* inchi-key:
 
* inchi-key:
** ddhcsalwdprvcn-uswkvxsksa-j
+
** mpcajmnynogxpb-kvtdhhqdsa-n
 
* molecular-weight:
 
* molecular-weight:
** 1021.905
+
** 164.158
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-13064]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13426]]
 
* [[RXN-16041]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=stearidonoyl-coa}}
+
{{#set: common-name=1,5-anhydro-d-mannitol}}
{{#set: inchi-key=inchikey=ddhcsalwdprvcn-uswkvxsksa-j}}
+
{{#set: inchi-key=inchikey=mpcajmnynogxpb-kvtdhhqdsa-n}}
{{#set: molecular-weight=1021.905}}
+
{{#set: molecular-weight=164.158}}

Revision as of 13:09, 14 January 2021

Metabolite CPD-9446

  • common-name:
    • 1,5-anhydro-d-mannitol
  • smiles:
    • c(o)c1(occ(o)c(o)c(o)1)
  • inchi-key:
    • mpcajmnynogxpb-kvtdhhqdsa-n
  • molecular-weight:
    • 164.158

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality