Difference between revisions of "PROCOLLAGEN-L-PROLINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DUTP == * common-name: ** dutp * smiles: ** c(c2(c(cc(n1(c(nc(c=c1)=o)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite Protein-L-serines == * common-name: ** a [protein]-l-serine == Reaction(s) known to consume the compound == * 2.4.1.221-RXN * 2.4.2...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Protein-L-serines == |
* common-name: | * common-name: | ||
− | ** | + | ** a [protein]-l-serine |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2.4.1.221-RXN]] |
− | * [[ | + | * [[2.4.2.26-RXN]] |
− | + | * [[2.7.12.1-RXN]] | |
− | * [[ | + | * [[RXN-11889]] |
− | |||
− | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[2.4.1.221-RXN]] |
− | * [[ | + | * [[2.7.12.1-RXN]] |
− | + | * [[RXN-11889]] | |
− | * [[ | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a [protein]-l-serine}} |
− | |||
− |
Revision as of 13:09, 14 January 2021
Contents
Metabolite Protein-L-serines
- common-name:
- a [protein]-l-serine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [protein]-l-serine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.