Difference between revisions of "CPD0-1162"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-DIPHOSPHO-1D-MYO-INOSITOL-12346P == * common-name: ** 1d-myoinositol 5-diphosphate 1,2,3,4,6-pentakisphosphate * smiles: ** c1(op([o-])...")
(Created page with "Category:metabolite == Metabolite Cysteine-Desulfurase-L-cysteine == * common-name: ** an [l-cysteine desulfurase]-l-cysteine == Reaction(s) known to consume the compound...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5-DIPHOSPHO-1D-MYO-INOSITOL-12346P ==
+
== Metabolite Cysteine-Desulfurase-L-cysteine ==
 
* common-name:
 
* common-name:
** 1d-myoinositol 5-diphosphate 1,2,3,4,6-pentakisphosphate
+
** an [l-cysteine desulfurase]-l-cysteine
* smiles:
 
** c1(op([o-])([o-])=o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o-])(=o)op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
 
* inchi-key:
 
** uphpwxpnziozjl-kxxvrosksa-a
 
* molecular-weight:
 
** 726.913
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.4.24-RXN]]
+
* [[RXN-12587]]
* [[RXN-10964]]
+
* [[RXN0-308]]
* [[RXN-10965]]
 
* [[RXN-10979]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.1.152-RXN]]
+
* [[RXN-12473]]
* [[RXN-10965]]
+
* [[RXN-12587]]
 +
* [[RXN-14382]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1d-myoinositol 5-diphosphate 1,2,3,4,6-pentakisphosphate}}
+
{{#set: common-name=an [l-cysteine desulfurase]-l-cysteine}}
{{#set: inchi-key=inchikey=uphpwxpnziozjl-kxxvrosksa-a}}
 
{{#set: molecular-weight=726.913}}
 

Revision as of 13:09, 14 January 2021

Metabolite Cysteine-Desulfurase-L-cysteine

  • common-name:
    • an [l-cysteine desulfurase]-l-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an [l-cysteine desulfurase]-l-cysteine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.