Difference between revisions of "CPD-4568"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DNA-Holder == * common-name: ** dna == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound == * 3...") |
(Created page with "Category:metabolite == Metabolite LIOTHYRONINE == * common-name: ** 3,5,3'-triiodo-l-thyronine * smiles: ** c1(c=c(o)c(i)=cc=1oc2(=c(i)c=c(c=c(i)2)cc([n+])c(=o)[o-])) * in...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite LIOTHYRONINE == |
* common-name: | * common-name: | ||
− | ** | + | ** 3,5,3'-triiodo-l-thyronine |
+ | * smiles: | ||
+ | ** c1(c=c(o)c(i)=cc=1oc2(=c(i)c=c(c=c(i)2)cc([n+])c(=o)[o-])) | ||
+ | * inchi-key: | ||
+ | ** auyycjsjgjycds-lbprgkrzsa-n | ||
+ | * molecular-weight: | ||
+ | ** 650.978 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-10607]] | ||
+ | * [[RXN-10609]] | ||
+ | * [[RXN-10615]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3,5,3'-triiodo-l-thyronine}} |
+ | {{#set: inchi-key=inchikey=auyycjsjgjycds-lbprgkrzsa-n}} | ||
+ | {{#set: molecular-weight=650.978}} |
Revision as of 13:09, 14 January 2021
Contents
Metabolite LIOTHYRONINE
- common-name:
- 3,5,3'-triiodo-l-thyronine
- smiles:
- c1(c=c(o)c(i)=cc=1oc2(=c(i)c=c(c=c(i)2)cc([n+])c(=o)[o-]))
- inchi-key:
- auyycjsjgjycds-lbprgkrzsa-n
- molecular-weight:
- 650.978